CAS 1005611-34-6 is the registry number for 1-((1-Ethyl-3-methyl-1H-pyrazol-4-yl)sulfonyl)piperidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(1-ethyl-3-methylpyrazol-4-yl)sulfonylpiperidine-3-carboxylic acid (CAS 1005611-34-6) is a chemical compound with the molecular formula C12H19N3O4S and a molecular weight of 301.36 g/mol. IUPAC name: 1-(1-ethyl-3-methylpyrazol-4-yl)sulfonylpiperidine-3-carboxylic acid. InChIKey: VJFZGFNBNLBZLA-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O4S |
|---|---|
| Molecular weight | 301.36 g/mol |
| IUPAC name | 1-(1-ethyl-3-methylpyrazol-4-yl)sulfonylpiperidine-3-carboxylic acid |
| InChIKey | VJFZGFNBNLBZLA-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=N1)C)S(=O)(=O)N2CCCC(C2)C(=O)O |
Computed by PubChem (NCBI)