CAS 956439-57-9 is the registry number for 1-((Trimethyl-1H-pyrazol-4-yl)sulfonyl)piperidine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxylic acid (CAS 956439-57-9) is a chemical compound with the molecular formula C12H19N3O4S and a molecular weight of 301.36 g/mol. IUPAC name: 1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxylic acid. InChIKey: KVQQYFCIAYGISQ-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O4S |
|---|---|
| Molecular weight | 301.36 g/mol |
| IUPAC name | 1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxylic acid |
| InChIKey | KVQQYFCIAYGISQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C)S(=O)(=O)N2CCC(CC2)C(=O)O |
Computed by PubChem (NCBI)