CAS 134720-07-3 appears in our catalog under these names: N-Nitroso Sotalol, N-Nitrososotalol, >95% (HPLC), N-Nitrososotalol. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 250mg, 500mg, 50mg, 25mg.
N-[4-[1-hydroxy-2-[nitroso(propan-2-yl)amino]ethyl]phenyl]methanesulfonamide (CAS 134720-07-3) is a chemical compound with the molecular formula C12H19N3O4S and a molecular weight of 301.36 g/mol. IUPAC name: N-[4-[1-hydroxy-2-[nitroso(propan-2-yl)amino]ethyl]phenyl]methanesulfonamide. InChIKey: JRGLEYZCDAJXQF-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O4S |
|---|---|
| Molecular weight | 301.36 g/mol |
| IUPAC name | N-[4-[1-hydroxy-2-[nitroso(propan-2-yl)amino]ethyl]phenyl]methanesulfonamide |
| InChIKey | JRGLEYZCDAJXQF-UHFFFAOYSA-N |
| SMILES | CC(C)N(CC(C1=CC=C(C=C1)NS(=O)(=O)C)O)N=O |
Computed by PubChem (NCBI)