Products 293764-50-8

CAS 293764-50-8 is the registry number for 4-({2-Amino-4-[(dimethylamino)sulfonyl]phenyl}amino)butanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[2-amino-4-(dimethylsulfamoyl)anilino]butanoic acid (CAS 293764-50-8) is a chemical compound with the molecular formula C12H19N3O4S and a molecular weight of 301.36 g/mol. IUPAC name: 4-[2-amino-4-(dimethylsulfamoyl)anilino]butanoic acid. InChIKey: JVVJFZHMFOPCPY-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19N3O4S
Molecular weight301.36 g/mol
IUPAC name4-[2-amino-4-(dimethylsulfamoyl)anilino]butanoic acid
InChIKeyJVVJFZHMFOPCPY-UHFFFAOYSA-N
SMILESCN(C)S(=O)(=O)C1=CC(=C(C=C1)NCCCC(=O)O)N

Computed by PubChem (NCBI)