CAS 1005632-06-3 appears in our catalog under these names: 5-[1-(3-Methyl-1h-pyrazol-1-yl)ethyl]-1,3,4-oxadiazole-2-thiol, 95%, 5-(1-(3-Methyl-1H-pyrazol-1-yl)ethyl)-1,3,4-oxadiazole-2-thiol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-[1-(3-methylpyrazol-1-yl)ethyl]-3H-1,3,4-oxadiazole-2-thione (CAS 1005632-06-3) is a chemical compound with the molecular formula C8H10N4OS and a molecular weight of 210.26 g/mol. IUPAC name: 5-[1-(3-methylpyrazol-1-yl)ethyl]-3H-1,3,4-oxadiazole-2-thione. InChIKey: RQBQRWNNGGFVAG-UHFFFAOYSA-N.
| Molecular formula | C8H10N4OS |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 5-[1-(3-methylpyrazol-1-yl)ethyl]-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | RQBQRWNNGGFVAG-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1)C(C)C2=NNC(=S)O2 |
Computed by PubChem (NCBI)