CAS 1029792-34-4 is the registry number for 5-Isopropyl-3-thioxo-2,8-dihydro-[1,2,4]triazolo[4,3-a]pyrimidin-7(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-propan-2-yl-3-sulfanylidene-2,8-dihydro-[1,2,4]triazolo[4,3-a]pyrimidin-7-one (CAS 1029792-34-4) is a chemical compound with the molecular formula C8H10N4OS and a molecular weight of 210.26 g/mol. IUPAC name: 5-propan-2-yl-3-sulfanylidene-2,8-dihydro-[1,2,4]triazolo[4,3-a]pyrimidin-7-one. InChIKey: VKVBJZTZDFRFNR-UHFFFAOYSA-N.
| Molecular formula | C8H10N4OS |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 5-propan-2-yl-3-sulfanylidene-2,8-dihydro-[1,2,4]triazolo[4,3-a]pyrimidin-7-one |
| InChIKey | VKVBJZTZDFRFNR-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=O)NC2=NNC(=S)N12 |
Computed by PubChem (NCBI)