CAS 1188499-24-2 is the registry number for 2-Amino-4-isopropylthiazolo[4,5-d]pyridazin-7(6H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-4-propan-2-yl-6H-[1,3]thiazolo[4,5-d]pyridazin-7-one (CAS 1188499-24-2) is a chemical compound with the molecular formula C8H10N4OS and a molecular weight of 210.26 g/mol. IUPAC name: 2-amino-4-propan-2-yl-6H-[1,3]thiazolo[4,5-d]pyridazin-7-one. InChIKey: LXZMNLBPBPNMRL-UHFFFAOYSA-N.
| Molecular formula | C8H10N4OS |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 2-amino-4-propan-2-yl-6H-[1,3]thiazolo[4,5-d]pyridazin-7-one |
| InChIKey | LXZMNLBPBPNMRL-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NNC(=O)C2=C1N=C(S2)N |
Computed by PubChem (NCBI)