CAS 676997-68-5 is the registry number for 1,3-Dimethyl-1H-thieno[2,3-c]pyrazole-5-carbohydrazide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dimethylthieno[3,2-d]pyrazole-5-carbohydrazide (CAS 676997-68-5) is a chemical compound with the molecular formula C8H10N4OS and a molecular weight of 210.26 g/mol. IUPAC name: 1,3-dimethylthieno[3,2-d]pyrazole-5-carbohydrazide. InChIKey: NEQROPWNYUVRQC-UHFFFAOYSA-N.
| Molecular formula | C8H10N4OS |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 1,3-dimethylthieno[3,2-d]pyrazole-5-carbohydrazide |
| InChIKey | NEQROPWNYUVRQC-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(S2)C(=O)NN)C |
Computed by PubChem (NCBI)