CAS 100564-98-5 is the registry number for Bestatin Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
(4R,5S)-4-benzyl-2-oxo-1,3-oxazolidine-5-carboxylic acid (CAS 100564-98-5) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: (4R,5S)-4-benzyl-2-oxo-1,3-oxazolidine-5-carboxylic acid. InChIKey: FBUUHKVPEQLWKF-BDAKNGLRSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | (4R,5S)-4-benzyl-2-oxo-1,3-oxazolidine-5-carboxylic acid |
| InChIKey | FBUUHKVPEQLWKF-BDAKNGLRSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H]2[C@H](OC(=O)N2)C(=O)O |
Computed by PubChem (NCBI)