CAS 1005646-64-9 is the registry number for 1-((5-Phenyl-2H-1,2,3,4-tetrazol-2-yl)methyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[(5-phenyltetrazol-2-yl)methyl]pyrazole-3-carboxylic acid (CAS 1005646-64-9) is a chemical compound with the molecular formula C12H10N6O2 and a molecular weight of 270.25 g/mol. IUPAC name: 1-[(5-phenyltetrazol-2-yl)methyl]pyrazole-3-carboxylic acid. InChIKey: UGXKJUFRIUUVII-UHFFFAOYSA-N.
| Molecular formula | C12H10N6O2 |
|---|---|
| Molecular weight | 270.25 g/mol |
| IUPAC name | 1-[(5-phenyltetrazol-2-yl)methyl]pyrazole-3-carboxylic acid |
| InChIKey | UGXKJUFRIUUVII-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(N=N2)CN3C=CC(=N3)C(=O)O |
Computed by PubChem (NCBI)