CAS 889999-45-5 is the registry number for (3-(Pyridin-3-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)glycine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3-pyridin-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]acetic acid (CAS 889999-45-5) is a chemical compound with the molecular formula C12H10N6O2 and a molecular weight of 270.25 g/mol. IUPAC name: 2-[(3-pyridin-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]acetic acid. InChIKey: PCKXZCBMJYIDAI-UHFFFAOYSA-N.
| Molecular formula | C12H10N6O2 |
|---|---|
| Molecular weight | 270.25 g/mol |
| IUPAC name | 2-[(3-pyridin-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]acetic acid |
| InChIKey | PCKXZCBMJYIDAI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NN=C3N2N=C(C=C3)NCC(=O)O |
Computed by PubChem (NCBI)