CAS 32502-20-8 appears in our catalog under these names: 3-Pyridine toxoflavin, 98%, 1,6–Dimethyl–3–(pyridin–4–yl)pyrimido(5,4–e)(1,2,4)triazine–5,7(1H,6H)–dione, 3-pyridine toxoflavin/ 99.83% (existing batch purity), 1,6-Dimethyl-3-(4-pyridinyl)pyrimido[5,4-e]-1,2,4-triazine-5,7(1H,6H)-dione, 99.93% ,, 99.93% ,, 3-Pyridine toxoflavin. Offered by: AmBeed, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1g, 100mg, 250mg, 1mg, 5mg, 10mg, 25mg, 50mg.
1,6-dimethyl-3-pyridin-4-ylpyrimido[5,4-e][1,2,4]triazine-5,7-dione (CAS 32502-20-8) is a chemical compound with the molecular formula C12H10N6O2 and a molecular weight of 270.25 g/mol. IUPAC name: 1,6-dimethyl-3-pyridin-4-ylpyrimido[5,4-e][1,2,4]triazine-5,7-dione. InChIKey: SYAZUOOOZFIYOB-UHFFFAOYSA-N.
| Molecular formula | C12H10N6O2 |
|---|---|
| Molecular weight | 270.25 g/mol |
| IUPAC name | 1,6-dimethyl-3-pyridin-4-ylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| InChIKey | SYAZUOOOZFIYOB-UHFFFAOYSA-N |
| SMILES | CN1C2=NC(=O)N(C(=O)C2=NC(=N1)C3=CC=NC=C3)C |
Computed by PubChem (NCBI)