CAS 85623-02-5 is the registry number for 3-Benzyl-4-oxo-3,4-dihydroimidazo(5,1-d)(1,2,3,5)tetrazine-8-carboxamide, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
3-benzyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide (CAS 85623-02-5) is a chemical compound with the molecular formula C12H10N6O2 and a molecular weight of 270.25 g/mol. IUPAC name: 3-benzyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide. InChIKey: LNPSWLFCAODLDZ-UHFFFAOYSA-N.
| Molecular formula | C12H10N6O2 |
|---|---|
| Molecular weight | 270.25 g/mol |
| IUPAC name | 3-benzyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
| InChIKey | LNPSWLFCAODLDZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)N3C=NC(=C3N=N2)C(=O)N |
Computed by PubChem (NCBI)