CAS 1005785-87-4 appears in our catalog under these names: 6-(Trifluoromethyl)imidazo[1,2-a]pyridin-2-amine, 95%, 6-(Trifluoromethyl)imidazo[1,2-a]pyridin-2-amine 98%, 6-(Trifluoromethyl)imidazo[1,2-a]pyridin-2-amine, 97%, 97%, 6-(TRIFLUOROMETHYL)IMIDAZO[1,2-A]PYRIDIN-2-AMINE, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-amine (CAS 1005785-87-4) is a chemical compound with the molecular formula C8H6F3N3 and a molecular weight of 201.15 g/mol. IUPAC name: 6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-amine. InChIKey: ORRZCFMOOYJHJF-UHFFFAOYSA-N.
| Molecular formula | C8H6F3N3 |
|---|---|
| Molecular weight | 201.15 g/mol |
| IUPAC name | 6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-amine |
| InChIKey | ORRZCFMOOYJHJF-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1C(F)(F)F)N |
Computed by PubChem (NCBI)