Products 1186501-73-4
CAS 1186501-73-4 appears in our catalog under these names: 3-(Trifluoromethyl)-1h-pyrrolo[2,3-b]pyridin-5-amine, 95%, 5-Amino-3-(trifluoromethyl)-7-azaindole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-5-amine (CAS 1186501-73-4) is a chemical compound with the molecular formula C8H6F3N3 and a molecular weight of 201.15 g/mol. IUPAC name: 3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-5-amine. InChIKey: HPOJMMBIENNOOO-UHFFFAOYSA-N.
| Molecular formula | C8H6F3N3 |
|---|---|
| Molecular weight | 201.15 g/mol |
| IUPAC name | 3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-5-amine |
| InChIKey | HPOJMMBIENNOOO-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=CN2)C(F)(F)F)N |
Computed by PubChem (NCBI)