CAS 1277178-21-8 is the registry number for 3-Methyl-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine (CAS 1277178-21-8) is a chemical compound with the molecular formula C8H6F3N3 and a molecular weight of 201.15 g/mol. IUPAC name: 3-methyl-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: AFPARSJWGXPLDN-UHFFFAOYSA-N.
| Molecular formula | C8H6F3N3 |
|---|---|
| Molecular weight | 201.15 g/mol |
| IUPAC name | 3-methyl-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | AFPARSJWGXPLDN-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)