CAS 2891455-71-1 is the registry number for 6-(Trifluoromethyl)-1H-pyrrolo[3,2-b]pyridin-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridin-5-amine (CAS 2891455-71-1) is a chemical compound with the molecular formula C8H6F3N3 and a molecular weight of 201.15 g/mol. IUPAC name: 6-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridin-5-amine. InChIKey: OOMWJOPTHRPGAN-UHFFFAOYSA-N.
| Molecular formula | C8H6F3N3 |
|---|---|
| Molecular weight | 201.15 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridin-5-amine |
| InChIKey | OOMWJOPTHRPGAN-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1N=C(C(=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)