CAS 1006218-85-4 is the registry number for N-(1-(1,5-Dimethyl-1H-pyrazol-4-yl)ethyl)methanesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]methanesulfonamide (CAS 1006218-85-4) is a chemical compound with the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. IUPAC name: N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]methanesulfonamide. InChIKey: DPWJNSPPALAEBZ-UHFFFAOYSA-N.
| Molecular formula | C8H15N3O2S |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | N-[1-(1,5-dimethylpyrazol-4-yl)ethyl]methanesulfonamide |
| InChIKey | DPWJNSPPALAEBZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C)C(C)NS(=O)(=O)C |
Computed by PubChem (NCBI)