CAS 902678-35-7 is the registry number for N-((1,3,5-Trimethyl-1H-pyrazol-4-yl)methyl)methanesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(1,3,5-trimethylpyrazol-4-yl)methyl]methanesulfonamide (CAS 902678-35-7) is a chemical compound with the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. IUPAC name: N-[(1,3,5-trimethylpyrazol-4-yl)methyl]methanesulfonamide. InChIKey: OOUFTMUMAXLUJH-UHFFFAOYSA-N.
| Molecular formula | C8H15N3O2S |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | N-[(1,3,5-trimethylpyrazol-4-yl)methyl]methanesulfonamide |
| InChIKey | OOUFTMUMAXLUJH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C)CNS(=O)(=O)C |
Computed by PubChem (NCBI)