CAS 1476111-78-0 is the registry number for 3-(tert-Butyl)-1-methyl-1H-pyrazole-4-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-tert-butyl-1-methylpyrazole-4-sulfonamide (CAS 1476111-78-0) is a chemical compound with the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. IUPAC name: 3-tert-butyl-1-methylpyrazole-4-sulfonamide. InChIKey: XMOSSRHBQAHNLO-UHFFFAOYSA-N.
| Molecular formula | C8H15N3O2S |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | 3-tert-butyl-1-methylpyrazole-4-sulfonamide |
| InChIKey | XMOSSRHBQAHNLO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C=C1S(=O)(=O)N)C |
Computed by PubChem (NCBI)