CAS 1240284-63-2 appears in our catalog under these names: N-Ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide, 95%, N-Ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide (CAS 1240284-63-2) is a chemical compound with the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. IUPAC name: N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide. InChIKey: UQRNEGSLXZOVMP-UHFFFAOYSA-N.
| Molecular formula | C8H15N3O2S |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | N-ethyl-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide |
| InChIKey | UQRNEGSLXZOVMP-UHFFFAOYSA-N |
| SMILES | CCN(C)S(=O)(=O)C1=C(NN=C1C)C |
Computed by PubChem (NCBI)