CAS 100622-09-1 is the registry number for Noradrenaline (Norepinephrine) Impurity 72. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-bis(3,4-dihydroxyphenyl)ethanone (CAS 100622-09-1) is a chemical compound with the molecular formula C14H12O5 and a molecular weight of 260.24 g/mol. IUPAC name: 1,2-bis(3,4-dihydroxyphenyl)ethanone. InChIKey: OGWHXLUECATHCQ-UHFFFAOYSA-N.
| Molecular formula | C14H12O5 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 1,2-bis(3,4-dihydroxyphenyl)ethanone |
| InChIKey | OGWHXLUECATHCQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)C2=CC(=C(C=C2)O)O)O)O |
Computed by PubChem (NCBI)