CAS 13709-20-1 is the registry number for 6-(2-(3,4-Dihydroxyphenyl)ethenyl)-4-methoxy-2H-pyran-2-one. Offered by: TRC. Available pack sizes: 100mg.
6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-4-methoxypyran-2-one (CAS 13709-20-1) is a chemical compound with the molecular formula C14H12O5 and a molecular weight of 260.24 g/mol. IUPAC name: 6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-4-methoxypyran-2-one. InChIKey: DEVZTLWLEZLGST-DUXPYHPUSA-N.
| Molecular formula | C14H12O5 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-4-methoxypyran-2-one |
| InChIKey | DEVZTLWLEZLGST-DUXPYHPUSA-N |
| SMILES | COC1=CC(=O)OC(=C1)/C=C/C2=CC(=C(C=C2)O)O |
Computed by PubChem (NCBI)