CAS 100632-57-3 is the registry number for Ibutilide Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-(methanesulfonamido)phenyl]-4-oxobutanoic acid (CAS 100632-57-3) is a chemical compound with the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. IUPAC name: 4-[4-(methanesulfonamido)phenyl]-4-oxobutanoic acid. InChIKey: SJLUQBVGSCLNRB-UHFFFAOYSA-N.
| Molecular formula | C11H13NO5S |
|---|---|
| Molecular weight | 271.29 g/mol |
| IUPAC name | 4-[4-(methanesulfonamido)phenyl]-4-oxobutanoic acid |
| InChIKey | SJLUQBVGSCLNRB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=C(C=C1)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)