CAS 1006348-70-4 is the registry number for 3-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-1-phenyl-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(1-ethyl-5-methylpyrazol-4-yl)-1-phenylpyrazole-4-carboxylic acid (CAS 1006348-70-4) is a chemical compound with the molecular formula C16H16N4O2 and a molecular weight of 296.32 g/mol. IUPAC name: 3-(1-ethyl-5-methylpyrazol-4-yl)-1-phenylpyrazole-4-carboxylic acid. InChIKey: GYVQVSMZANSYPM-UHFFFAOYSA-N.
| Molecular formula | C16H16N4O2 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 3-(1-ethyl-5-methylpyrazol-4-yl)-1-phenylpyrazole-4-carboxylic acid |
| InChIKey | GYVQVSMZANSYPM-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C=N1)C2=NN(C=C2C(=O)O)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)