CAS 149981-23-7 is the registry number for 1-Allyl-3,7-dimethyl-8-phenylxanthine. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 100mg, 500mg.
3,7-dimethyl-8-phenyl-1-prop-2-enylpurine-2,6-dione (CAS 149981-23-7) is a chemical compound with the molecular formula C16H16N4O2 and a molecular weight of 296.32 g/mol. IUPAC name: 3,7-dimethyl-8-phenyl-1-prop-2-enylpurine-2,6-dione. InChIKey: DKISSNPEWQAXRA-UHFFFAOYSA-N.
| Molecular formula | C16H16N4O2 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 3,7-dimethyl-8-phenyl-1-prop-2-enylpurine-2,6-dione |
| InChIKey | DKISSNPEWQAXRA-UHFFFAOYSA-N |
| SMILES | CN1C2=C(N=C1C3=CC=CC=C3)N(C(=O)N(C2=O)CC=C)C |
Computed by PubChem (NCBI)