CAS 330999-50-3 is the registry number for N1-(6,7-Dimethoxyquinazolin-4-yl)benzene-1,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-N-(6,7-dimethoxyquinazolin-4-yl)benzene-1,4-diamine (CAS 330999-50-3) is a chemical compound with the molecular formula C16H16N4O2 and a molecular weight of 296.32 g/mol. IUPAC name: 4-N-(6,7-dimethoxyquinazolin-4-yl)benzene-1,4-diamine. InChIKey: FCQHLBNBKHUZIB-UHFFFAOYSA-N.
| Molecular formula | C16H16N4O2 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 4-N-(6,7-dimethoxyquinazolin-4-yl)benzene-1,4-diamine |
| InChIKey | FCQHLBNBKHUZIB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=C(C=C3)N)OC |
Computed by PubChem (NCBI)