CAS 916486-06-1 appears in our catalog under these names: Ethyl 2–(2–(methylamino)pyrimidin–4–yl)–1H–indole–5–carboxylate, Ethyl 2-(2-(methylamino)pyrimidin-4-yl)-1H-indole-5-carboxylate 96%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl 2-[2-(methylamino)pyrimidin-4-yl]-1H-indole-5-carboxylate (CAS 916486-06-1) is a chemical compound with the molecular formula C16H16N4O2 and a molecular weight of 296.32 g/mol. IUPAC name: ethyl 2-[2-(methylamino)pyrimidin-4-yl]-1H-indole-5-carboxylate. InChIKey: RRQRYXWYEZKEBT-UHFFFAOYSA-N.
| Molecular formula | C16H16N4O2 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | ethyl 2-[2-(methylamino)pyrimidin-4-yl]-1H-indole-5-carboxylate |
| InChIKey | RRQRYXWYEZKEBT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)NC(=C2)C3=NC(=NC=C3)NC |
Computed by PubChem (NCBI)