Products 1006461-93-3

CAS 1006461-93-3 is the registry number for 4-(5-Methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl)butanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]butanoic acid (CAS 1006461-93-3) is a chemical compound with the molecular formula C9H11F3N2O2 and a molecular weight of 236.19 g/mol. IUPAC name: 4-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]butanoic acid. InChIKey: UFNIIMKJJIBPNT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11F3N2O2
Molecular weight236.19 g/mol
IUPAC name4-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]butanoic acid
InChIKeyUFNIIMKJJIBPNT-UHFFFAOYSA-N
SMILESCC1=CC(=NN1CCCC(=O)O)C(F)(F)F

Computed by PubChem (NCBI)