CAS 1006462-32-3 is the registry number for 3,5-Dimethyl-1-(2,2,2-trifluoroethyl)-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid (CAS 1006462-32-3) is a chemical compound with the molecular formula C8H9F3N2O2 and a molecular weight of 222.16 g/mol. IUPAC name: 3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid. InChIKey: ADJINVHVZLLKDO-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2O2 |
|---|---|
| Molecular weight | 222.16 g/mol |
| IUPAC name | 3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid |
| InChIKey | ADJINVHVZLLKDO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(F)(F)F)C)C(=O)O |
Computed by PubChem (NCBI)