CAS 852228-09-2 is the registry number for Ethyl 1-methyl-5-(trifluoromethyl)-1h-pyrazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 1-methyl-5-(trifluoromethyl)pyrazole-3-carboxylate (CAS 852228-09-2) is a chemical compound with the molecular formula C8H9F3N2O2 and a molecular weight of 222.16 g/mol. IUPAC name: ethyl 1-methyl-5-(trifluoromethyl)pyrazole-3-carboxylate. InChIKey: KKZBEVWDQREDBA-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2O2 |
|---|---|
| Molecular weight | 222.16 g/mol |
| IUPAC name | ethyl 1-methyl-5-(trifluoromethyl)pyrazole-3-carboxylate |
| InChIKey | KKZBEVWDQREDBA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C(=C1)C(F)(F)F)C |
Computed by PubChem (NCBI)