Products 2388474-14-2

CAS 2388474-14-2 is the registry number for 3-(1-(2,2,2-Trifluoroethyl)-1H-pyrazol-5-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]propanoic acid (CAS 2388474-14-2) is a chemical compound with the molecular formula C8H9F3N2O2 and a molecular weight of 222.16 g/mol. IUPAC name: 3-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]propanoic acid. InChIKey: PMNGEMMUNVSISU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9F3N2O2
Molecular weight222.16 g/mol
IUPAC name3-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]propanoic acid
InChIKeyPMNGEMMUNVSISU-UHFFFAOYSA-N
SMILESC1=C(N(N=C1)CC(F)(F)F)CCC(=O)O

Computed by PubChem (NCBI)