CAS 2388474-14-2 is the registry number for 3-(1-(2,2,2-Trifluoroethyl)-1H-pyrazol-5-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]propanoic acid (CAS 2388474-14-2) is a chemical compound with the molecular formula C8H9F3N2O2 and a molecular weight of 222.16 g/mol. IUPAC name: 3-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]propanoic acid. InChIKey: PMNGEMMUNVSISU-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2O2 |
|---|---|
| Molecular weight | 222.16 g/mol |
| IUPAC name | 3-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]propanoic acid |
| InChIKey | PMNGEMMUNVSISU-UHFFFAOYSA-N |
| SMILES | C1=C(N(N=C1)CC(F)(F)F)CCC(=O)O |
Computed by PubChem (NCBI)