CAS 1153329-93-1 is the registry number for 3-(3-(Trifluoromethyl)-1H-pyrazol-1-yl)butanoic acid 98%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
3-[3-(trifluoromethyl)pyrazol-1-yl]butanoic acid (CAS 1153329-93-1) is a chemical compound with the molecular formula C8H9F3N2O2 and a molecular weight of 222.16 g/mol. IUPAC name: 3-[3-(trifluoromethyl)pyrazol-1-yl]butanoic acid. InChIKey: OWRBXDUQRMCGBL-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2O2 |
|---|---|
| Molecular weight | 222.16 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)pyrazol-1-yl]butanoic acid |
| InChIKey | OWRBXDUQRMCGBL-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)N1C=CC(=N1)C(F)(F)F |
Computed by PubChem (NCBI)