Products 1153329-93-1

CAS 1153329-93-1 is the registry number for 3-(3-(Trifluoromethyl)-1H-pyrazol-1-yl)butanoic acid 98%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-[3-(trifluoromethyl)pyrazol-1-yl]butanoic acid (CAS 1153329-93-1) is a chemical compound with the molecular formula C8H9F3N2O2 and a molecular weight of 222.16 g/mol. IUPAC name: 3-[3-(trifluoromethyl)pyrazol-1-yl]butanoic acid. InChIKey: OWRBXDUQRMCGBL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9F3N2O2
Molecular weight222.16 g/mol
IUPAC name3-[3-(trifluoromethyl)pyrazol-1-yl]butanoic acid
InChIKeyOWRBXDUQRMCGBL-UHFFFAOYSA-N
SMILESCC(CC(=O)O)N1C=CC(=N1)C(F)(F)F

Computed by PubChem (NCBI)