CAS 1006464-12-5 appears in our catalog under these names: 3-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1H-pyrazole-4-carboxylic acid, 95%, 3-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1H-pyrazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazole-4-carboxylic acid (CAS 1006464-12-5) is a chemical compound with the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. IUPAC name: 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazole-4-carboxylic acid. InChIKey: MVEKIIOGRJIBLX-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O4 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazole-4-carboxylic acid |
| InChIKey | MVEKIIOGRJIBLX-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C3=C(C=NN3)C(=O)O |
Computed by PubChem (NCBI)