CAS 100648-56-4 is the registry number for 4',5-Di-o-methyl quercetin. Offered by: Biosynth. Available pack sizes: 25mg, 50mg.
3,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-5-methoxychromen-4-one (CAS 100648-56-4) is a chemical compound with the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. IUPAC name: 3,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-5-methoxychromen-4-one. InChIKey: QTUNBLFELCXAOU-UHFFFAOYSA-N.
| Molecular formula | C17H14O7 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | 3,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-5-methoxychromen-4-one |
| InChIKey | QTUNBLFELCXAOU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(O2)C=C(C=C3OC)O)O)O |
Computed by PubChem (NCBI)