Products 1006483-02-8

CAS 1006483-02-8 is the registry number for 3-(4-Chloro-1-methyl-1H-pyrazol-3-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(4-chloro-1-methylpyrazol-3-yl)propanoic acid (CAS 1006483-02-8) is a chemical compound with the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. IUPAC name: 3-(4-chloro-1-methylpyrazol-3-yl)propanoic acid. InChIKey: FJQNUNBQWRUPSI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9ClN2O2
Molecular weight188.61 g/mol
IUPAC name3-(4-chloro-1-methylpyrazol-3-yl)propanoic acid
InChIKeyFJQNUNBQWRUPSI-UHFFFAOYSA-N
SMILESCN1C=C(C(=N1)CCC(=O)O)Cl

Computed by PubChem (NCBI)