CAS 1006487-19-9 appears in our catalog under these names: 1-(2,2,2-Trifluoroethyl)-1H-pyrazole-4-sulfonyl chloride, 98%, 1-(2,2,2-Trifluoroethyl)-1H-pyrazole-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonyl chloride (CAS 1006487-19-9) is a chemical compound with the molecular formula C5H4ClF3N2O2S and a molecular weight of 248.61 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonyl chloride. InChIKey: APYOSJHRHDKPEH-UHFFFAOYSA-N.
| Molecular formula | C5H4ClF3N2O2S |
|---|---|
| Molecular weight | 248.61 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)pyrazole-4-sulfonyl chloride |
| InChIKey | APYOSJHRHDKPEH-UHFFFAOYSA-N |
| SMILES | C1=C(C=NN1CC(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)