Products 884340-52-7

CAS 884340-52-7 is the registry number for 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-5-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-methyl-3-(trifluoromethyl)pyrazole-5-sulfonyl chloride (CAS 884340-52-7) is a chemical compound with the molecular formula C5H4ClF3N2O2S and a molecular weight of 248.61 g/mol. IUPAC name: 1-methyl-3-(trifluoromethyl)pyrazole-5-sulfonyl chloride. InChIKey: MORWFSVOFMNQDO-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4ClF3N2O2S
Molecular weight248.61 g/mol
IUPAC name1-methyl-3-(trifluoromethyl)pyrazole-5-sulfonyl chloride
InChIKeyMORWFSVOFMNQDO-UHFFFAOYSA-N
SMILESCN1C(=CC(=N1)C(F)(F)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)