CAS 519056-67-8 appears in our catalog under these names: 1-Methyl-3-(trifluoromethyl)-1h-pyrazole-4-sulfonyl chloride, 95%, 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-sulfonyl chloride, 97% , 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-sulfonyl chloride, 99%, 99%. Offered by: Combi-blocks, Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-methyl-3-(trifluoromethyl)pyrazole-4-sulfonyl chloride (CAS 519056-67-8) is a chemical compound with the molecular formula C5H4ClF3N2O2S and a molecular weight of 248.61 g/mol. IUPAC name: 1-methyl-3-(trifluoromethyl)pyrazole-4-sulfonyl chloride. InChIKey: HJFWSNIHZZKYIK-UHFFFAOYSA-N.
| Molecular formula | C5H4ClF3N2O2S |
|---|---|
| Molecular weight | 248.61 g/mol |
| IUPAC name | 1-methyl-3-(trifluoromethyl)pyrazole-4-sulfonyl chloride |
| InChIKey | HJFWSNIHZZKYIK-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)