CAS 1354706-47-0 is the registry number for 1-(2,2,2-Trifluoroethyl)-1H-pyrazole-3-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 5g.
1-(2,2,2-trifluoroethyl)pyrazole-3-sulfonyl chloride (CAS 1354706-47-0) is a chemical compound with the molecular formula C5H4ClF3N2O2S and a molecular weight of 248.61 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)pyrazole-3-sulfonyl chloride. InChIKey: LHEWERHADPJETO-UHFFFAOYSA-N.
| Molecular formula | C5H4ClF3N2O2S |
|---|---|
| Molecular weight | 248.61 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)pyrazole-3-sulfonyl chloride |
| InChIKey | LHEWERHADPJETO-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1S(=O)(=O)Cl)CC(F)(F)F |
Computed by PubChem (NCBI)