CAS 1006494-30-9 is the registry number for 3-(1-Benzyl-3-(p-tolyl)-1H-pyrazol-4-yl)acrylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(E)-3-[1-benzyl-3-(4-methylphenyl)pyrazol-4-yl]prop-2-enoic acid (CAS 1006494-30-9) is a chemical compound with the molecular formula C20H18N2O2 and a molecular weight of 318.4 g/mol. IUPAC name: (E)-3-[1-benzyl-3-(4-methylphenyl)pyrazol-4-yl]prop-2-enoic acid. InChIKey: NIUCUIMSWMUESV-VAWYXSNFSA-N.
| Molecular formula | C20H18N2O2 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | (E)-3-[1-benzyl-3-(4-methylphenyl)pyrazol-4-yl]prop-2-enoic acid |
| InChIKey | NIUCUIMSWMUESV-VAWYXSNFSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN(C=C2/C=C/C(=O)O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)