CAS 99117-21-2 appears in our catalog under these names: 2-Benzyl-1,2,3,4-tetrahydro-benzo[b][1,6]naphthyridine-10-carboxylic acid, 95%, 2-Benzyl-1H,2H,3H,4H-benzo(b)1,6-naphthyridine-10-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 2,5g.
2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid (CAS 99117-21-2) is a chemical compound with the molecular formula C20H18N2O2 and a molecular weight of 318.4 g/mol. IUPAC name: 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid. InChIKey: WWVSDQYFRSUJAZ-UHFFFAOYSA-N.
| Molecular formula | C20H18N2O2 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid |
| InChIKey | WWVSDQYFRSUJAZ-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C(C3=CC=CC=C3N=C21)C(=O)O)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)