CAS 957022-85-4 appears in our catalog under these names: (2E)-3-[1-(4-Methylbenzyl)-3-phenyl-1h-pyrazol-4-yl]acrylic acid, 95%, (2E)-3-{1-((4-Methylphenyl)methyl)-3-phenyl-1H-pyrazol-4-yl}prop-2-enoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
(E)-3-[1-[(4-methylphenyl)methyl]-3-phenylpyrazol-4-yl]prop-2-enoic acid (CAS 957022-85-4) is a chemical compound with the molecular formula C20H18N2O2 and a molecular weight of 318.4 g/mol. IUPAC name: (E)-3-[1-[(4-methylphenyl)methyl]-3-phenylpyrazol-4-yl]prop-2-enoic acid. InChIKey: FFHXTJJVOADTNT-VAWYXSNFSA-N.
| Molecular formula | C20H18N2O2 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | (E)-3-[1-[(4-methylphenyl)methyl]-3-phenylpyrazol-4-yl]prop-2-enoic acid |
| InChIKey | FFHXTJJVOADTNT-VAWYXSNFSA-N |
| SMILES | CC1=CC=C(C=C1)CN2C=C(C(=N2)C3=CC=CC=C3)/C=C/C(=O)O |
Computed by PubChem (NCBI)