CAS 94514-45-1 is the registry number for (3Z,6Z)-3,6-Dibenzylidene-1,4-dimethylpiperazine-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3Z,6Z)-3,6-dibenzylidene-1,4-dimethylpiperazine-2,5-dione (CAS 94514-45-1) is a chemical compound with the molecular formula C20H18N2O2 and a molecular weight of 318.4 g/mol. IUPAC name: (3Z,6Z)-3,6-dibenzylidene-1,4-dimethylpiperazine-2,5-dione. InChIKey: WFIPKWCWCOEGSY-JTFWXBGUSA-N.
| Molecular formula | C20H18N2O2 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | (3Z,6Z)-3,6-dibenzylidene-1,4-dimethylpiperazine-2,5-dione |
| InChIKey | WFIPKWCWCOEGSY-JTFWXBGUSA-N |
| SMILES | CN\1C(=O)/C(=C/C2=CC=CC=C2)/N(C(=O)/C1=C/C3=CC=CC=C3)C |
Computed by PubChem (NCBI)