Products 1006494-91-2
CAS 1006494-91-2 is the registry number for Ethyl (2e)-(hydroxyimino)(1,3,5-trimethyl-1h-pyrazol-4-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Ethyl (2E)-2-hydroxyimino-2-(1,3,5-trimethylpyrazol-4-yl)acetate (CAS 1006494-91-2) is a chemical compound with the molecular formula C10H15N3O3 and a molecular weight of 225.24 g/mol. IUPAC name: ethyl (2E)-2-hydroxyimino-2-(1,3,5-trimethylpyrazol-4-yl)acetate. InChIKey: XKAXFWNCAMMSEV-FMIVXFBMSA-N.
| Molecular formula | C10H15N3O3 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | ethyl (2E)-2-hydroxyimino-2-(1,3,5-trimethylpyrazol-4-yl)acetate |
| InChIKey | XKAXFWNCAMMSEV-FMIVXFBMSA-N |
| SMILES | CCOC(=O)/C(=N/O)/C1=C(N(N=C1C)C)C |
Computed by PubChem (NCBI)