CAS 219694-63-0 appears in our catalog under these names: Ingavirin, 4-{(2-(1H-Imidazol-5-yl)ethyl)carbamoyl}butanoic acid, Ingavirin 95%, 5-((2-(1H-Imidazol-5-yl)ethyl)amino)-5-oxopentanoic acid, 95%, 95%, Ingavirin, 99.88%. Offered by: Chemat Brand, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: on request, 1000mg, 5000mg, 100mg, 250mg, 1g, 1 g, 250 mg.
5-[2-(1H-imidazol-5-yl)ethylamino]-5-oxopentanoic acid (CAS 219694-63-0) is a chemical compound with the molecular formula C10H15N3O3 and a molecular weight of 225.24 g/mol. IUPAC name: 5-[2-(1H-imidazol-5-yl)ethylamino]-5-oxopentanoic acid. InChIKey: KZIMLUFVKJLCCH-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O3 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 5-[2-(1H-imidazol-5-yl)ethylamino]-5-oxopentanoic acid |
| InChIKey | KZIMLUFVKJLCCH-UHFFFAOYSA-N |
| SMILES | C1=C(NC=N1)CCNC(=O)CCCC(=O)O |
Computed by PubChem (NCBI)