Products 1212059-41-0

CAS 1212059-41-0 is the registry number for Methyl 4-cyclohexyl-5-oxo-4,5-dihydro-1h-1,2,4-triazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-cyclohexyl-5-oxo-1H-1,2,4-triazole-3-carboxylate (CAS 1212059-41-0) is a chemical compound with the molecular formula C10H15N3O3 and a molecular weight of 225.24 g/mol. IUPAC name: methyl 4-cyclohexyl-5-oxo-1H-1,2,4-triazole-3-carboxylate. InChIKey: ZDNNKZRQLUFWFX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15N3O3
Molecular weight225.24 g/mol
IUPAC namemethyl 4-cyclohexyl-5-oxo-1H-1,2,4-triazole-3-carboxylate
InChIKeyZDNNKZRQLUFWFX-UHFFFAOYSA-N
SMILESCOC(=O)C1=NNC(=O)N1C2CCCCC2

Computed by PubChem (NCBI)