CAS 329922-39-6 appears in our catalog under these names: 2-((2-[(4-Nitrophenyl)amino]ethyl)amino)ethanol, 95%, 2-((2-((4-Nitrophenyl)amino)ethyl)amino)ethanol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-[2-(4-nitroanilino)ethylamino]ethanol (CAS 329922-39-6) is a chemical compound with the molecular formula C10H15N3O3 and a molecular weight of 225.24 g/mol. IUPAC name: 2-[2-(4-nitroanilino)ethylamino]ethanol. InChIKey: IDMVTHVTTMCJEV-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O3 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 2-[2-(4-nitroanilino)ethylamino]ethanol |
| InChIKey | IDMVTHVTTMCJEV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NCCNCCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)