Products 1006592-57-9
CAS 1006592-57-9 appears in our catalog under these names: 10-Undecynoyl-OSu, 10-Undecynoyl-OSu, 98%, 2,5-Dioxopyrrolidin-1-yl undec-10-ynoate, 98%, 2,5-Dioxopyrrolidin-1-yl Undec-10-ynoate, 95.0%. Offered by: Iris Biotech, MedChemExpress, Ambeed, BLDpharm, Chemat. Available pack sizes: 1g, 5g, 250mg, 500mg, 1 g, 250 mg, 100 mg, 50 mg.
(2,5-dioxopyrrolidin-1-yl) undec-10-ynoate (CAS 1006592-57-9) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) undec-10-ynoate. InChIKey: PUOUPBMTHXHXBB-UHFFFAOYSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) undec-10-ynoate |
| InChIKey | PUOUPBMTHXHXBB-UHFFFAOYSA-N |
| SMILES | C#CCCCCCCCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)