CAS 1006620-01-4 is the registry number for 2-Amino-3,5-dichloro-N-isopropylbenzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-3,5-dichloro-N-propan-2-ylbenzamide (CAS 1006620-01-4) is a chemical compound with the molecular formula C10H12Cl2N2O and a molecular weight of 247.12 g/mol. IUPAC name: 2-amino-3,5-dichloro-N-propan-2-ylbenzamide. InChIKey: WKBYLCWABDZFPT-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2O |
|---|---|
| Molecular weight | 247.12 g/mol |
| IUPAC name | 2-amino-3,5-dichloro-N-propan-2-ylbenzamide |
| InChIKey | WKBYLCWABDZFPT-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=C(C(=CC(=C1)Cl)Cl)N |
Computed by PubChem (NCBI)